About 5-cyclohexyl-1-ethyl-1,3,5-triazinane-2-thione
5-cyclohexyl-1-ethyl-1,3,5-triazinane-2-thione (PubChem CID 950749) has the molecular formula C11H21N3S
and a molecular weight of 227.38 g/mol. Its IUPAC name is 5-cyclohexyl-1-ethyl-1,3,5-triazinane-2-thione.
Molecular Properties
| Compound Name | 5-cyclohexyl-1-ethyl-1,3,5-triazinane-2-thione |
| PubChem CID | 950749 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 5-cyclohexyl-1-ethyl-1,3,5-triazinane-2-thione |
| SMILES | CCN1CN(C2CCCCC2)CNC1=S |
| InChI | InChI=1S/C11H21N3S/c1-2-13-9-14(8-12-11(13)15)10-6-4-3-5-7-10/h10H,2-9H2,1H3,(H,12,15) |
| InChIKey | NMOBWQTVPAUEOX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexyl-1-ethyl-1,3,5-triazinane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-1-ethyl-1,3,5-triazinane-2-thione?
The IUPAC name of 5-cyclohexyl-1-ethyl-1,3,5-triazinane-2-thione (CID 950749) is 5-cyclohexyl-1-ethyl-1,3,5-triazinane-2-thione.
What is the SMILES notation for 5-cyclohexyl-1-ethyl-1,3,5-triazinane-2-thione?
The canonical SMILES for 5-cyclohexyl-1-ethyl-1,3,5-triazinane-2-thione is CCN1CN(C2CCCCC2)CNC1=S.
What is the InChIKey of 5-cyclohexyl-1-ethyl-1,3,5-triazinane-2-thione?
The InChIKey is NMOBWQTVPAUEOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3S/c1-2-13-9-14(8-12-11(13)15)10-6-4-3-5-7-10/h10H,2-9H2,1H3,(H,12,15).
What are the key properties of 5-cyclohexyl-1-ethyl-1,3,5-triazinane-2-thione?
5-cyclohexyl-1-ethyl-1,3,5-triazinane-2-thione has a molecular weight of 227.38 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-1-ethyl-1,3,5-triazinane-2-thione is sourced from PubChem (CID 950749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).