C28H33N5O3 — CID 95075119
(2S)-N-[(4-butoxyphenyl)methyl]-2-(3,7-dimethyl-4-oxo-2-phenylpyrazolo[3,4-d]pyridazin-5-yl)butanamide (PubChem CID 95075119) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is (2S)-N-[(4-butoxyphenyl)methyl]-2-(3,7-dimethyl-4-oxo-2-phenylpyrazolo[3,4-d]pyridazin-5-yl)butanamide.
| Compound Name | (2S)-N-[(4-butoxyphenyl)methyl]-2-(3,7-dimethyl-4-oxo-2-phenylpyrazolo[3,4-d]pyridazin-5-yl)butanamide |
|---|---|
| PubChem CID | 95075119 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | (2S)-N-[(4-butoxyphenyl)methyl]-2-(3,7-dimethyl-4-oxo-2-phenylpyrazolo[3,4-d]pyridazin-5-yl)butanamide |
| SMILES | CCCCOc1ccc(CNC(=O)[C@H](CC)n2nc(C)c3nn(-c4ccccc4)c(C)c3c2=O)cc1 |
| InChI | InChI=1S/C28H33N5O3/c1-5-7-17-36-23-15-13-21(14-16-23)18-29-27(34)24(6-2)33-28(35)25-20(4)32(22-11-9-8-10-12-22)31-26(25)19(3)30-33/h8-16,24H,5-7,17-18H2,1-4H3,(H,29,34)/t24-/m0/s1 |
| InChIKey | WDKYUYDPRASROO-DEOSSOPVSA-N |
| XLogP | 4.65 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|