About 3-naphthalen-2-yloxy-1-benzothiophene 1,1-dioxide
3-naphthalen-2-yloxy-1-benzothiophene 1,1-dioxide (PubChem CID 950756) has the molecular formula C18H12O3S
and a molecular weight of 308.36 g/mol. Its IUPAC name is 3-naphthalen-2-yloxy-1-benzothiophene 1,1-dioxide.
Molecular Properties
| Compound Name | 3-naphthalen-2-yloxy-1-benzothiophene 1,1-dioxide |
| PubChem CID | 950756 |
| Molecular Formula | C18H12O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 3-naphthalen-2-yloxy-1-benzothiophene 1,1-dioxide |
| SMILES | O=S1(=O)C=C(Oc2ccc3ccccc3c2)c2ccccc21 |
| InChI | InChI=1S/C18H12O3S/c19-22(20)12-17(16-7-3-4-8-18(16)22)21-15-10-9-13-5-1-2-6-14(13)11-15/h1-12H |
| InChIKey | QWCWVNFIUXCSGG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-naphthalen-2-yloxy-1-benzothiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-naphthalen-2-yloxy-1-benzothiophene 1,1-dioxide?
The IUPAC name of 3-naphthalen-2-yloxy-1-benzothiophene 1,1-dioxide (CID 950756) is 3-naphthalen-2-yloxy-1-benzothiophene 1,1-dioxide.
What is the SMILES notation for 3-naphthalen-2-yloxy-1-benzothiophene 1,1-dioxide?
The canonical SMILES for 3-naphthalen-2-yloxy-1-benzothiophene 1,1-dioxide is O=S1(=O)C=C(Oc2ccc3ccccc3c2)c2ccccc21.
What is the InChIKey of 3-naphthalen-2-yloxy-1-benzothiophene 1,1-dioxide?
The InChIKey is QWCWVNFIUXCSGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O3S/c19-22(20)12-17(16-7-3-4-8-18(16)22)21-15-10-9-13-5-1-2-6-14(13)11-15/h1-12H.
What are the key properties of 3-naphthalen-2-yloxy-1-benzothiophene 1,1-dioxide?
3-naphthalen-2-yloxy-1-benzothiophene 1,1-dioxide has a molecular weight of 308.36 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-naphthalen-2-yloxy-1-benzothiophene 1,1-dioxide is sourced from PubChem (CID 950756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).