C16H15N5OS — CID 950819
3-(4-ethoxyphenyl)-4-(pyridin-3-ylmethylideneamino)-1H-1,2,4-triazole-5-thione (PubChem CID 950819) has the molecular formula C16H15N5OS and a molecular weight of 325.40 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-4-(pyridin-3-ylmethylideneamino)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-ethoxyphenyl)-4-(pyridin-3-ylmethylideneamino)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 950819 |
| Molecular Formula | C16H15N5OS |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-(4-ethoxyphenyl)-4-(pyridin-3-ylmethylideneamino)-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1ccc(-c2n[nH]c(=S)n2N=Cc2cccnc2)cc1 |
| InChI | InChI=1S/C16H15N5OS/c1-2-22-14-7-5-13(6-8-14)15-19-20-16(23)21(15)18-11-12-4-3-9-17-10-12/h3-11H,2H2,1H3,(H,20,23) |
| InChIKey | BHNVIQSXGPXUPI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 68.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|