C22H24N4OS — CID 95084873
1-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1-methylurea (PubChem CID 95084873) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is 1-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1-methylurea.
| Compound Name | 1-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 95084873 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1-methylurea |
| SMILES | Cc1[nH]c2ccc(CNC(=O)N(C)[C@H](C)c3nc4ccccc4s3)cc2c1C |
| InChI | InChI=1S/C22H24N4OS/c1-13-14(2)24-18-10-9-16(11-17(13)18)12-23-22(27)26(4)15(3)21-25-19-7-5-6-8-20(19)28-21/h5-11,15,24H,12H2,1-4H3,(H,23,27)/t15-/m1/s1 |
| InChIKey | JXEYFRNEPKYMRP-OAHLLOKOSA-N |
| XLogP | 5.30 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|