C24H20FN3O2 — CID 95086738
(2R)-N-(3-fluoro-4-methylphenyl)-2-(4-quinoxalin-2-ylphenoxy)propanamide (PubChem CID 95086738) has the molecular formula C24H20FN3O2 and a molecular weight of 401.44 g/mol. Its IUPAC name is (2R)-N-(3-fluoro-4-methylphenyl)-2-(4-quinoxalin-2-ylphenoxy)propanamide.
| Compound Name | (2R)-N-(3-fluoro-4-methylphenyl)-2-(4-quinoxalin-2-ylphenoxy)propanamide |
|---|---|
| PubChem CID | 95086738 |
| Molecular Formula | C24H20FN3O2 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | (2R)-N-(3-fluoro-4-methylphenyl)-2-(4-quinoxalin-2-ylphenoxy)propanamide |
| SMILES | Cc1ccc(NC(=O)[C@@H](C)Oc2ccc(-c3cnc4ccccc4n3)cc2)cc1F |
| InChI | InChI=1S/C24H20FN3O2/c1-15-7-10-18(13-20(15)25)27-24(29)16(2)30-19-11-8-17(9-12-19)23-14-26-21-5-3-4-6-22(21)28-23/h3-14,16H,1-2H3,(H,27,29)/t16-/m1/s1 |
| InChIKey | SPWMJSFJQOPWQU-MRXNPFEDSA-N |
| XLogP | 5.15 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |