C18H28N2O4 — CID 95086958
(2S,6S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2,6-dimethylmorpholine-4-carboxamide (PubChem CID 95086958) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is (2S,6S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2,6-dimethylmorpholine-4-carboxamide.
| Compound Name | (2S,6S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2,6-dimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 95086958 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (2S,6S)-N-[3-(3,4-dimethoxyphenyl)propyl]-2,6-dimethylmorpholine-4-carboxamide |
| SMILES | COc1ccc(CCCNC(=O)N2C[C@H](C)O[C@@H](C)C2)cc1OC |
| InChI | InChI=1S/C18H28N2O4/c1-13-11-20(12-14(2)24-13)18(21)19-9-5-6-15-7-8-16(22-3)17(10-15)23-4/h7-8,10,13-14H,5-6,9,11-12H2,1-4H3,(H,19,21)/t13-,14-/m0/s1 |
| InChIKey | CNCNIXYXVMYOGG-KBPBESRZSA-N |
| XLogP | 2.46 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|