C22H25BrN2O3 — CID 95087327
(3S)-1-(4-bromobenzoyl)-N-[(4-methoxyphenyl)methyl]-3-methylpiperidine-3-carboxamide (PubChem CID 95087327) has the molecular formula C22H25BrN2O3 and a molecular weight of 445.36 g/mol. Its IUPAC name is (3S)-1-(4-bromobenzoyl)-N-[(4-methoxyphenyl)methyl]-3-methylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-bromobenzoyl)-N-[(4-methoxyphenyl)methyl]-3-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 95087327 |
| Molecular Formula | C22H25BrN2O3 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | (3S)-1-(4-bromobenzoyl)-N-[(4-methoxyphenyl)methyl]-3-methylpiperidine-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)[C@@]2(C)CCCN(C(=O)c3ccc(Br)cc3)C2)cc1 |
| InChI | InChI=1S/C22H25BrN2O3/c1-22(21(27)24-14-16-4-10-19(28-2)11-5-16)12-3-13-25(15-22)20(26)17-6-8-18(23)9-7-17/h4-11H,3,12-15H2,1-2H3,(H,24,27)/t22-/m0/s1 |
| InChIKey | ZVCSLCMPZQMOEZ-QFIPXVFZSA-N |
| XLogP | 4.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |