About N-[4-[3-[[(2R)-butan-2-yl]sulfamoyl]-4-methylphenyl]-3-ethyl-1,2-oxazol-5-yl]acetamide
N-[4-[3-[[(2R)-butan-2-yl]sulfamoyl]-4-methylphenyl]-3-ethyl-1,2-oxazol-5-yl]acetamide (PubChem CID 95092633) has the molecular formula C18H25N3O4S
and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[4-[3-[[(2R)-butan-2-yl]sulfamoyl]-4-methylphenyl]-3-ethyl-1,2-oxazol-5-yl]acetamide.
Molecular Properties
| Compound Name | N-[4-[3-[[(2R)-butan-2-yl]sulfamoyl]-4-methylphenyl]-3-ethyl-1,2-oxazol-5-yl]acetamide |
| PubChem CID | 95092633 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[4-[3-[[(2R)-butan-2-yl]sulfamoyl]-4-methylphenyl]-3-ethyl-1,2-oxazol-5-yl]acetamide |
| SMILES | CCc1noc(NC(C)=O)c1-c1ccc(C)c(S(=O)(=O)N[C@H](C)CC)c1 |
| InChI | InChI=1S/C18H25N3O4S/c1-6-12(4)21-26(23,24)16-10-14(9-8-11(16)3)17-15(7-2)20-25-18(17)19-13(5)22/h8-10,12,21H,6-7H2,1-5H3,(H,19,22)/t12-/m1/s1 |
| InChIKey | DCMROWWZNGYDJR-GFCCVEGCSA-N |
| XLogP | 3.25 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[3-[[(2R)-butan-2-yl]sulfamoyl]-4-methylphenyl]-3-ethyl-1,2-oxazol-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[3-[[(2R)-butan-2-yl]sulfamoyl]-4-methylphenyl]-3-ethyl-1,2-oxazol-5-yl]acetamide?
The IUPAC name of N-[4-[3-[[(2R)-butan-2-yl]sulfamoyl]-4-methylphenyl]-3-ethyl-1,2-oxazol-5-yl]acetamide (CID 95092633) is N-[4-[3-[[(2R)-butan-2-yl]sulfamoyl]-4-methylphenyl]-3-ethyl-1,2-oxazol-5-yl]acetamide.
What is the SMILES notation for N-[4-[3-[[(2R)-butan-2-yl]sulfamoyl]-4-methylphenyl]-3-ethyl-1,2-oxazol-5-yl]acetamide?
The canonical SMILES for N-[4-[3-[[(2R)-butan-2-yl]sulfamoyl]-4-methylphenyl]-3-ethyl-1,2-oxazol-5-yl]acetamide is CCc1noc(NC(C)=O)c1-c1ccc(C)c(S(=O)(=O)N[C@H](C)CC)c1.
What is the InChIKey of N-[4-[3-[[(2R)-butan-2-yl]sulfamoyl]-4-methylphenyl]-3-ethyl-1,2-oxazol-5-yl]acetamide?
The InChIKey is DCMROWWZNGYDJR-GFCCVEGCSA-N. The full InChI is InChI=1S/C18H25N3O4S/c1-6-12(4)21-26(23,24)16-10-14(9-8-11(16)3)17-15(7-2)20-25-18(17)19-13(5)22/h8-10,12,21H,6-7H2,1-5H3,(H,19,22)/t12-/m1/s1.
What are the key properties of N-[4-[3-[[(2R)-butan-2-yl]sulfamoyl]-4-methylphenyl]-3-ethyl-1,2-oxazol-5-yl]acetamide?
N-[4-[3-[[(2R)-butan-2-yl]sulfamoyl]-4-methylphenyl]-3-ethyl-1,2-oxazol-5-yl]acetamide has a molecular weight of 379.48 g/mol, XLogP of 3.25, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[3-[[(2R)-butan-2-yl]sulfamoyl]-4-methylphenyl]-3-ethyl-1,2-oxazol-5-yl]acetamide is sourced from PubChem (CID 95092633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).