C24H31FN4O2 — CID 95093926
(3R)-3-[3-[[4-(dimethylamino)phenyl]methylamino]-3-oxopropyl]-N-(4-fluorophenyl)piperidine-1-carboxamide (PubChem CID 95093926) has the molecular formula C24H31FN4O2 and a molecular weight of 426.54 g/mol. Its IUPAC name is (3R)-3-[3-[[4-(dimethylamino)phenyl]methylamino]-3-oxopropyl]-N-(4-fluorophenyl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-[3-[[4-(dimethylamino)phenyl]methylamino]-3-oxopropyl]-N-(4-fluorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95093926 |
| Molecular Formula | C24H31FN4O2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (3R)-3-[3-[[4-(dimethylamino)phenyl]methylamino]-3-oxopropyl]-N-(4-fluorophenyl)piperidine-1-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)CC[C@H]2CCCN(C(=O)Nc3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C24H31FN4O2/c1-28(2)22-12-5-18(6-13-22)16-26-23(30)14-7-19-4-3-15-29(17-19)24(31)27-21-10-8-20(25)9-11-21/h5-6,8-13,19H,3-4,7,14-17H2,1-2H3,(H,26,30)(H,27,31)/t19-/m1/s1 |
| InChIKey | KWMNSUZGOHDREV-LJQANCHMSA-N |
| XLogP | 4.23 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|