C17H21N3O3 — CID 95094681
methyl (2S)-2-[(3-methyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-10-carbonyl)amino]propanoate (PubChem CID 95094681) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl (2S)-2-[(3-methyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-10-carbonyl)amino]propanoate.
| Compound Name | methyl (2S)-2-[(3-methyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-10-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 95094681 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | methyl (2S)-2-[(3-methyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-10-carbonyl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)N1CCc2cn(C)c3cccc(c23)C1 |
| InChI | InChI=1S/C17H21N3O3/c1-11(16(21)23-3)18-17(22)20-8-7-13-9-19(2)14-6-4-5-12(10-20)15(13)14/h4-6,9,11H,7-8,10H2,1-3H3,(H,18,22)/t11-/m0/s1 |
| InChIKey | PZZNDUSLVZIIOZ-NSHDSACASA-N |
| XLogP | 1.81 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |