C21H27N3O2S2 — CID 95097313
2-methyl-N-[2-[2-[(3S)-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-3-yl]-1,3-thiazol-4-yl]ethyl]propanamide (PubChem CID 95097313) has the molecular formula C21H27N3O2S2 and a molecular weight of 417.60 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-[(3S)-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-3-yl]-1,3-thiazol-4-yl]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[2-[(3S)-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-3-yl]-1,3-thiazol-4-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 95097313 |
| Molecular Formula | C21H27N3O2S2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-methyl-N-[2-[2-[(3S)-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-3-yl]-1,3-thiazol-4-yl]ethyl]propanamide |
| SMILES | CC(C)C(=O)NCCc1csc([C@H]2CCCN(C(=O)/C=C/c3cccs3)C2)n1 |
| InChI | InChI=1S/C21H27N3O2S2/c1-15(2)20(26)22-10-9-17-14-28-21(23-17)16-5-3-11-24(13-16)19(25)8-7-18-6-4-12-27-18/h4,6-8,12,14-16H,3,5,9-11,13H2,1-2H3,(H,22,26)/b8-7+/t16-/m0/s1 |
| InChIKey | UUKVZLMLMNGGBU-WAVCKPEOSA-N |
| XLogP | 3.94 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|