C23H27ClN2O3 — CID 95097997
4-[[(3R)-1-(2-chlorobenzoyl)piperidin-3-yl]methoxy]-N-propan-2-ylbenzamide (PubChem CID 95097997) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is 4-[[(3R)-1-(2-chlorobenzoyl)piperidin-3-yl]methoxy]-N-propan-2-ylbenzamide.
| Compound Name | 4-[[(3R)-1-(2-chlorobenzoyl)piperidin-3-yl]methoxy]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 95097997 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 4-[[(3R)-1-(2-chlorobenzoyl)piperidin-3-yl]methoxy]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(OC[C@@H]2CCCN(C(=O)c3ccccc3Cl)C2)cc1 |
| InChI | InChI=1S/C23H27ClN2O3/c1-16(2)25-22(27)18-9-11-19(12-10-18)29-15-17-6-5-13-26(14-17)23(28)20-7-3-4-8-21(20)24/h3-4,7-12,16-17H,5-6,13-15H2,1-2H3,(H,25,27)/t17-/m1/s1 |
| InChIKey | IYYWOMDNKCQTIN-QGZVFWFLSA-N |
| XLogP | 4.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |