C17H23N3O4 — CID 95104286
(3S)-5-methoxy-N-(2-methoxyethyl)-1-methyl-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxamide (PubChem CID 95104286) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is (3S)-5-methoxy-N-(2-methoxyethyl)-1-methyl-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxamide.
| Compound Name | (3S)-5-methoxy-N-(2-methoxyethyl)-1-methyl-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxamide |
|---|---|
| PubChem CID | 95104286 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (3S)-5-methoxy-N-(2-methoxyethyl)-1-methyl-2-oxospiro[indole-3,3'-pyrrolidine]-1'-carboxamide |
| SMILES | COCCNC(=O)N1CC[C@]2(C1)C(=O)N(C)c1ccc(OC)cc12 |
| InChI | InChI=1S/C17H23N3O4/c1-19-14-5-4-12(24-3)10-13(14)17(15(19)21)6-8-20(11-17)16(22)18-7-9-23-2/h4-5,10H,6-9,11H2,1-3H3,(H,18,22)/t17-/m1/s1 |
| InChIKey | MTJZXLDIUWTXHQ-QGZVFWFLSA-N |
| XLogP | 0.97 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|