C23H26N4O2 — CID 95105668
(2R)-2-phenyl-N-[1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)cyclohexyl]butanamide (PubChem CID 95105668) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is (2R)-2-phenyl-N-[1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)cyclohexyl]butanamide.
| Compound Name | (2R)-2-phenyl-N-[1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)cyclohexyl]butanamide |
|---|---|
| PubChem CID | 95105668 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (2R)-2-phenyl-N-[1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)cyclohexyl]butanamide |
| SMILES | CC[C@@H](C(=O)NC1(c2nc(-c3cccnc3)no2)CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H26N4O2/c1-2-19(17-10-5-3-6-11-17)21(28)26-23(13-7-4-8-14-23)22-25-20(27-29-22)18-12-9-15-24-16-18/h3,5-6,9-12,15-16,19H,2,4,7-8,13-14H2,1H3,(H,26,28)/t19-/m1/s1 |
| InChIKey | VAUJFDZIWVLOSR-LJQANCHMSA-N |
| XLogP | 4.60 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |