C13H22N4O3S — CID 95107248
5-[[(3R)-3-(dimethylsulfamoylamino)pyrrolidin-1-yl]methyl]-2-methoxypyridine (PubChem CID 95107248) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 5-[[(3R)-3-(dimethylsulfamoylamino)pyrrolidin-1-yl]methyl]-2-methoxypyridine.
| Compound Name | 5-[[(3R)-3-(dimethylsulfamoylamino)pyrrolidin-1-yl]methyl]-2-methoxypyridine |
|---|---|
| PubChem CID | 95107248 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 5-[[(3R)-3-(dimethylsulfamoylamino)pyrrolidin-1-yl]methyl]-2-methoxypyridine |
| SMILES | COc1ccc(CN2CC[C@@H](NS(=O)(=O)N(C)C)C2)cn1 |
| InChI | InChI=1S/C13H22N4O3S/c1-16(2)21(18,19)15-12-6-7-17(10-12)9-11-4-5-13(20-3)14-8-11/h4-5,8,12,15H,6-7,9-10H2,1-3H3/t12-/m1/s1 |
| InChIKey | LCJPYCYJBJQDAL-GFCCVEGCSA-N |
| XLogP | 0.06 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |