C23H30N4O2S — CID 95109495
(6R)-N-(2,4-dimethylphenyl)-2-(4-propanoylpiperazin-1-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide (PubChem CID 95109495) has the molecular formula C23H30N4O2S and a molecular weight of 426.59 g/mol. Its IUPAC name is (6R)-N-(2,4-dimethylphenyl)-2-(4-propanoylpiperazin-1-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide.
| Compound Name | (6R)-N-(2,4-dimethylphenyl)-2-(4-propanoylpiperazin-1-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 95109495 |
| Molecular Formula | C23H30N4O2S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | (6R)-N-(2,4-dimethylphenyl)-2-(4-propanoylpiperazin-1-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxamide |
| SMILES | CCC(=O)N1CCN(c2nc3c(s2)C[C@H](C(=O)Nc2ccc(C)cc2C)CC3)CC1 |
| InChI | InChI=1S/C23H30N4O2S/c1-4-21(28)26-9-11-27(12-10-26)23-25-19-8-6-17(14-20(19)30-23)22(29)24-18-7-5-15(2)13-16(18)3/h5,7,13,17H,4,6,8-12,14H2,1-3H3,(H,24,29)/t17-/m1/s1 |
| InChIKey | TXVKBGIXLLBOQT-QGZVFWFLSA-N |
| XLogP | 3.56 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |