C17H25N3O — CID 95111669
pyridin-4-yl-[(2R)-2-(2-pyrrolidin-1-ylethyl)piperidin-1-yl]methanone (PubChem CID 95111669) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is pyridin-4-yl-[(2R)-2-(2-pyrrolidin-1-ylethyl)piperidin-1-yl]methanone.
| Compound Name | pyridin-4-yl-[(2R)-2-(2-pyrrolidin-1-ylethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95111669 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | pyridin-4-yl-[(2R)-2-(2-pyrrolidin-1-ylethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccncc1)N1CCCC[C@@H]1CCN1CCCC1 |
| InChI | InChI=1S/C17H25N3O/c21-17(15-6-9-18-10-7-15)20-13-2-1-5-16(20)8-14-19-11-3-4-12-19/h6-7,9-10,16H,1-5,8,11-14H2/t16-/m1/s1 |
| InChIKey | SKCDSKOLPQMQAA-MRXNPFEDSA-N |
| XLogP | 2.56 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |