C19H17ClN4O2 — CID 95116517
(2-chloro-3-pyridinyl)-[(2S)-2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanone (PubChem CID 95116517) has the molecular formula C19H17ClN4O2 and a molecular weight of 368.82 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl)-[(2S)-2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanone.
| Compound Name | (2-chloro-3-pyridinyl)-[(2S)-2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95116517 |
| Molecular Formula | C19H17ClN4O2 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (2-chloro-3-pyridinyl)-[(2S)-2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanone |
| SMILES | Cc1cccc(-c2noc([C@@H]3CCCN3C(=O)c3cccnc3Cl)n2)c1 |
| InChI | InChI=1S/C19H17ClN4O2/c1-12-5-2-6-13(11-12)17-22-18(26-23-17)15-8-4-10-24(15)19(25)14-7-3-9-21-16(14)20/h2-3,5-7,9,11,15H,4,8,10H2,1H3/t15-/m0/s1 |
| InChIKey | XLTJSPQGVMWMAF-HNNXBMFYSA-N |
| XLogP | 4.07 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|