C13H15N3O2S — CID 951189
1,5-bis(furan-2-ylmethyl)-1,3,5-triazinane-2-thione (PubChem CID 951189) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 1,5-bis(furan-2-ylmethyl)-1,3,5-triazinane-2-thione.
| Compound Name | 1,5-bis(furan-2-ylmethyl)-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 951189 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1,5-bis(furan-2-ylmethyl)-1,3,5-triazinane-2-thione |
| SMILES | S=C1NCN(Cc2ccco2)CN1Cc1ccco1 |
| InChI | InChI=1S/C13H15N3O2S/c19-13-14-9-15(7-11-3-1-5-17-11)10-16(13)8-12-4-2-6-18-12/h1-6H,7-10H2,(H,14,19) |
| InChIKey | KNZYHFLKSJRQOB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 44.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|