C18H16ClN3O3 — CID 95119018
(2R)-N-(3-chloro-4-methoxyphenyl)-2-(1-oxophthalazin-2-yl)propanamide (PubChem CID 95119018) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is (2R)-N-(3-chloro-4-methoxyphenyl)-2-(1-oxophthalazin-2-yl)propanamide.
| Compound Name | (2R)-N-(3-chloro-4-methoxyphenyl)-2-(1-oxophthalazin-2-yl)propanamide |
|---|---|
| PubChem CID | 95119018 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | (2R)-N-(3-chloro-4-methoxyphenyl)-2-(1-oxophthalazin-2-yl)propanamide |
| SMILES | COc1ccc(NC(=O)[C@@H](C)n2ncc3ccccc3c2=O)cc1Cl |
| InChI | InChI=1S/C18H16ClN3O3/c1-11(17(23)21-13-7-8-16(25-2)15(19)9-13)22-18(24)14-6-4-3-5-12(14)10-20-22/h3-11H,1-2H3,(H,21,23)/t11-/m1/s1 |
| InChIKey | OEFQPYFOEWBVIL-LLVKDONJSA-N |
| XLogP | 3.26 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |