C21H15F3N2O2S — CID 95119223
(6S)-15-hydroxy-6-phenyl-9-(trifluoromethyl)-17-thia-2,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),14-pentaen-13-one (PubChem CID 95119223) has the molecular formula C21H15F3N2O2S and a molecular weight of 416.42 g/mol. Its IUPAC name is (6S)-15-hydroxy-6-phenyl-9-(trifluoromethyl)-17-thia-2,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),14-pentaen-13-one.
| Compound Name | (6S)-15-hydroxy-6-phenyl-9-(trifluoromethyl)-17-thia-2,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),14-pentaen-13-one |
|---|---|
| PubChem CID | 95119223 |
| Molecular Formula | C21H15F3N2O2S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (6S)-15-hydroxy-6-phenyl-9-(trifluoromethyl)-17-thia-2,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),14-pentaen-13-one |
| SMILES | O=c1cc(O)c2sc3nc4c(c(C(F)(F)F)c3c2[nH]1)C[C@@H](c1ccccc1)CC4 |
| InChI | InChI=1S/C21H15F3N2O2S/c22-21(23,24)17-12-8-11(10-4-2-1-3-5-10)6-7-13(12)25-20-16(17)18-19(29-20)14(27)9-15(28)26-18/h1-5,9,11H,6-8H2,(H2,26,27,28)/t11-/m0/s1 |
| InChIKey | ZCXPEDBXMWCLTK-NSHDSACASA-N |
| XLogP | 5.13 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |