C20H19N5OS — CID 95119616
(13S)-13-[1-(3,4-dimethylphenyl)pyrazol-4-yl]-5-thia-2,7,10-triazatricyclo[6.5.0.02,6]trideca-1(8),3,6-trien-11-one (PubChem CID 95119616) has the molecular formula C20H19N5OS and a molecular weight of 377.47 g/mol. Its IUPAC name is (13S)-13-[1-(3,4-dimethylphenyl)pyrazol-4-yl]-5-thia-2,7,10-triazatricyclo[6.5.0.02,6]trideca-1(8),3,6-trien-11-one.
| Compound Name | (13S)-13-[1-(3,4-dimethylphenyl)pyrazol-4-yl]-5-thia-2,7,10-triazatricyclo[6.5.0.02,6]trideca-1(8),3,6-trien-11-one |
|---|---|
| PubChem CID | 95119616 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (13S)-13-[1-(3,4-dimethylphenyl)pyrazol-4-yl]-5-thia-2,7,10-triazatricyclo[6.5.0.02,6]trideca-1(8),3,6-trien-11-one |
| SMILES | Cc1ccc(-n2cc([C@@H]3CC(=O)NCc4nc5sccn5c43)cn2)cc1C |
| InChI | InChI=1S/C20H19N5OS/c1-12-3-4-15(7-13(12)2)25-11-14(9-22-25)16-8-18(26)21-10-17-19(16)24-5-6-27-20(24)23-17/h3-7,9,11,16H,8,10H2,1-2H3,(H,21,26)/t16-/m0/s1 |
| InChIKey | PJOUEJVPWXAUJH-INIZCTEOSA-N |
| XLogP | 3.35 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |