C19H19NO3 — CID 95119643
(4R)-4-(3-ethenylphenyl)-5,7-dimethoxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 95119643) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is (4R)-4-(3-ethenylphenyl)-5,7-dimethoxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | (4R)-4-(3-ethenylphenyl)-5,7-dimethoxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 95119643 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (4R)-4-(3-ethenylphenyl)-5,7-dimethoxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | C=Cc1cccc([C@H]2CC(=O)Nc3cc(OC)cc(OC)c32)c1 |
| InChI | InChI=1S/C19H19NO3/c1-4-12-6-5-7-13(8-12)15-11-18(21)20-16-9-14(22-2)10-17(23-3)19(15)16/h4-10,15H,1,11H2,2-3H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | PHKSFRZZFAXXAN-OAHLLOKOSA-N |
| XLogP | 3.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |