About 1-[4-[[(1S)-2,2-dimethyl-1-phenylcyclopropyl]methyl-methylamino]piperidin-1-yl]ethanone
1-[4-[[(1S)-2,2-dimethyl-1-phenylcyclopropyl]methyl-methylamino]piperidin-1-yl]ethanone (PubChem CID 95119683) has the molecular formula C20H30N2O
and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-[4-[[(1S)-2,2-dimethyl-1-phenylcyclopropyl]methyl-methylamino]piperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[[(1S)-2,2-dimethyl-1-phenylcyclopropyl]methyl-methylamino]piperidin-1-yl]ethanone |
| PubChem CID | 95119683 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 1-[4-[[(1S)-2,2-dimethyl-1-phenylcyclopropyl]methyl-methylamino]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(N(C)C[C@@]2(c3ccccc3)CC2(C)C)CC1 |
| InChI | InChI=1S/C20H30N2O/c1-16(23)22-12-10-18(11-13-22)21(4)15-20(14-19(20,2)3)17-8-6-5-7-9-17/h5-9,18H,10-15H2,1-4H3/t20-/m1/s1 |
| InChIKey | XWHOLQXSNYLKDQ-HXUWFJFHSA-N |
| XLogP | 3.30 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-[[(1S)-2,2-dimethyl-1-phenylcyclopropyl]methyl-methylamino]piperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[[(1S)-2,2-dimethyl-1-phenylcyclopropyl]methyl-methylamino]piperidin-1-yl]ethanone?
The IUPAC name of 1-[4-[[(1S)-2,2-dimethyl-1-phenylcyclopropyl]methyl-methylamino]piperidin-1-yl]ethanone (CID 95119683) is 1-[4-[[(1S)-2,2-dimethyl-1-phenylcyclopropyl]methyl-methylamino]piperidin-1-yl]ethanone.
What is the SMILES notation for 1-[4-[[(1S)-2,2-dimethyl-1-phenylcyclopropyl]methyl-methylamino]piperidin-1-yl]ethanone?
The canonical SMILES for 1-[4-[[(1S)-2,2-dimethyl-1-phenylcyclopropyl]methyl-methylamino]piperidin-1-yl]ethanone is CC(=O)N1CCC(N(C)C[C@@]2(c3ccccc3)CC2(C)C)CC1.
What is the InChIKey of 1-[4-[[(1S)-2,2-dimethyl-1-phenylcyclopropyl]methyl-methylamino]piperidin-1-yl]ethanone?
The InChIKey is XWHOLQXSNYLKDQ-HXUWFJFHSA-N. The full InChI is InChI=1S/C20H30N2O/c1-16(23)22-12-10-18(11-13-22)21(4)15-20(14-19(20,2)3)17-8-6-5-7-9-17/h5-9,18H,10-15H2,1-4H3/t20-/m1/s1.
What are the key properties of 1-[4-[[(1S)-2,2-dimethyl-1-phenylcyclopropyl]methyl-methylamino]piperidin-1-yl]ethanone?
1-[4-[[(1S)-2,2-dimethyl-1-phenylcyclopropyl]methyl-methylamino]piperidin-1-yl]ethanone has a molecular weight of 314.47 g/mol, XLogP of 3.30, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[[(1S)-2,2-dimethyl-1-phenylcyclopropyl]methyl-methylamino]piperidin-1-yl]ethanone is sourced from PubChem (CID 95119683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).