C20H25N3O3 — CID 95120471
N'-[(2R)-1-hydroxybutan-2-yl]-N-(4-methylphenyl)-N'-(pyridin-2-ylmethyl)propanediamide (PubChem CID 95120471) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N'-[(2R)-1-hydroxybutan-2-yl]-N-(4-methylphenyl)-N'-(pyridin-2-ylmethyl)propanediamide.
| Compound Name | N'-[(2R)-1-hydroxybutan-2-yl]-N-(4-methylphenyl)-N'-(pyridin-2-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 95120471 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N'-[(2R)-1-hydroxybutan-2-yl]-N-(4-methylphenyl)-N'-(pyridin-2-ylmethyl)propanediamide |
| SMILES | CC[C@H](CO)N(Cc1ccccn1)C(=O)CC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C20H25N3O3/c1-3-18(14-24)23(13-17-6-4-5-11-21-17)20(26)12-19(25)22-16-9-7-15(2)8-10-16/h4-11,18,24H,3,12-14H2,1-2H3,(H,22,25)/t18-/m1/s1 |
| InChIKey | HYJFBHTYDMTNFY-GOSISDBHSA-N |
| XLogP | 2.52 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|