About 4-[2-[(3R)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-5-fluoropyrimidin-4-yl]morpholine
4-[2-[(3R)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-5-fluoropyrimidin-4-yl]morpholine (PubChem CID 95120956) has the molecular formula C17H23FN6O
and a molecular weight of 346.41 g/mol. Its IUPAC name is 4-[2-[(3R)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-5-fluoropyrimidin-4-yl]morpholine.
Molecular Properties
| Compound Name | 4-[2-[(3R)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-5-fluoropyrimidin-4-yl]morpholine |
| PubChem CID | 95120956 |
| Molecular Formula | C17H23FN6O |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-[2-[(3R)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-5-fluoropyrimidin-4-yl]morpholine |
| SMILES | Cc1cc(C)n([C@@H]2CCN(c3ncc(F)c(N4CCOCC4)n3)C2)n1 |
| InChI | InChI=1S/C17H23FN6O/c1-12-9-13(2)24(21-12)14-3-4-23(11-14)17-19-10-15(18)16(20-17)22-5-7-25-8-6-22/h9-10,14H,3-8,11H2,1-2H3/t14-/m1/s1 |
| InChIKey | FGKGWHCZPGNKNU-CQSZACIVSA-N |
| XLogP | 1.72 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[2-[(3R)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-5-fluoropyrimidin-4-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(3R)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-5-fluoropyrimidin-4-yl]morpholine?
The IUPAC name of 4-[2-[(3R)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-5-fluoropyrimidin-4-yl]morpholine (CID 95120956) is 4-[2-[(3R)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-5-fluoropyrimidin-4-yl]morpholine.
What is the SMILES notation for 4-[2-[(3R)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-5-fluoropyrimidin-4-yl]morpholine?
The canonical SMILES for 4-[2-[(3R)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-5-fluoropyrimidin-4-yl]morpholine is Cc1cc(C)n([C@@H]2CCN(c3ncc(F)c(N4CCOCC4)n3)C2)n1.
What is the InChIKey of 4-[2-[(3R)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-5-fluoropyrimidin-4-yl]morpholine?
The InChIKey is FGKGWHCZPGNKNU-CQSZACIVSA-N. The full InChI is InChI=1S/C17H23FN6O/c1-12-9-13(2)24(21-12)14-3-4-23(11-14)17-19-10-15(18)16(20-17)22-5-7-25-8-6-22/h9-10,14H,3-8,11H2,1-2H3/t14-/m1/s1.
What are the key properties of 4-[2-[(3R)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-5-fluoropyrimidin-4-yl]morpholine?
4-[2-[(3R)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-5-fluoropyrimidin-4-yl]morpholine has a molecular weight of 346.41 g/mol, XLogP of 1.72, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(3R)-3-(3,5-dimethylpyrazol-1-yl)pyrrolidin-1-yl]-5-fluoropyrimidin-4-yl]morpholine is sourced from PubChem (CID 95120956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).