C16H20N6O3S — CID 95122602
ethyl 2-[[5-[(8S)-2-amino-6-oxo-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-c]azepin-8-yl]pyrimidin-2-yl]-methylamino]acetate (PubChem CID 95122602) has the molecular formula C16H20N6O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is ethyl 2-[[5-[(8S)-2-amino-6-oxo-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-c]azepin-8-yl]pyrimidin-2-yl]-methylamino]acetate.
| Compound Name | ethyl 2-[[5-[(8S)-2-amino-6-oxo-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-c]azepin-8-yl]pyrimidin-2-yl]-methylamino]acetate |
|---|---|
| PubChem CID | 95122602 |
| Molecular Formula | C16H20N6O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | ethyl 2-[[5-[(8S)-2-amino-6-oxo-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-c]azepin-8-yl]pyrimidin-2-yl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)c1ncc([C@@H]2CC(=O)NCc3nc(N)sc32)cn1 |
| InChI | InChI=1S/C16H20N6O3S/c1-3-25-13(24)8-22(2)16-19-5-9(6-20-16)10-4-12(23)18-7-11-14(10)26-15(17)21-11/h5-6,10H,3-4,7-8H2,1-2H3,(H2,17,21)(H,18,23)/t10-/m0/s1 |
| InChIKey | IRCGIHUVLFFWHH-JTQLQIEISA-N |
| XLogP | 0.67 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |