About 2-[2-[[(2R)-1-methoxypropan-2-yl]amino]ethyl]-1H-pyridazine-3,6-dione
2-[2-[[(2R)-1-methoxypropan-2-yl]amino]ethyl]-1H-pyridazine-3,6-dione (PubChem CID 95126032) has the molecular formula C10H17N3O3
and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-[2-[[(2R)-1-methoxypropan-2-yl]amino]ethyl]-1H-pyridazine-3,6-dione.
Molecular Properties
| Compound Name | 2-[2-[[(2R)-1-methoxypropan-2-yl]amino]ethyl]-1H-pyridazine-3,6-dione |
| PubChem CID | 95126032 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-[2-[[(2R)-1-methoxypropan-2-yl]amino]ethyl]-1H-pyridazine-3,6-dione |
| SMILES | COC[C@@H](C)NCCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C10H17N3O3/c1-8(7-16-2)11-5-6-13-10(15)4-3-9(14)12-13/h3-4,8,11H,5-7H2,1-2H3,(H,12,14)/t8-/m1/s1 |
| InChIKey | QDHOXSBVZIOZRC-MRVPVSSYSA-N |
| XLogP | -0.84 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[[(2R)-1-methoxypropan-2-yl]amino]ethyl]-1H-pyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[(2R)-1-methoxypropan-2-yl]amino]ethyl]-1H-pyridazine-3,6-dione?
The IUPAC name of 2-[2-[[(2R)-1-methoxypropan-2-yl]amino]ethyl]-1H-pyridazine-3,6-dione (CID 95126032) is 2-[2-[[(2R)-1-methoxypropan-2-yl]amino]ethyl]-1H-pyridazine-3,6-dione.
What is the SMILES notation for 2-[2-[[(2R)-1-methoxypropan-2-yl]amino]ethyl]-1H-pyridazine-3,6-dione?
The canonical SMILES for 2-[2-[[(2R)-1-methoxypropan-2-yl]amino]ethyl]-1H-pyridazine-3,6-dione is COC[C@@H](C)NCCn1[nH]c(=O)ccc1=O.
What is the InChIKey of 2-[2-[[(2R)-1-methoxypropan-2-yl]amino]ethyl]-1H-pyridazine-3,6-dione?
The InChIKey is QDHOXSBVZIOZRC-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H17N3O3/c1-8(7-16-2)11-5-6-13-10(15)4-3-9(14)12-13/h3-4,8,11H,5-7H2,1-2H3,(H,12,14)/t8-/m1/s1.
What are the key properties of 2-[2-[[(2R)-1-methoxypropan-2-yl]amino]ethyl]-1H-pyridazine-3,6-dione?
2-[2-[[(2R)-1-methoxypropan-2-yl]amino]ethyl]-1H-pyridazine-3,6-dione has a molecular weight of 227.26 g/mol, XLogP of -0.84, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[(2R)-1-methoxypropan-2-yl]amino]ethyl]-1H-pyridazine-3,6-dione is sourced from PubChem (CID 95126032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).