C17H24N6O2 — CID 95126890
4-(4-methoxyphenyl)-N-[(1S)-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-carboxamide (PubChem CID 95126890) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N-[(1S)-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-methoxyphenyl)-N-[(1S)-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 95126890 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 4-(4-methoxyphenyl)-N-[(1S)-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)N[C@@H](C)c3nncn3C)CC2)cc1 |
| InChI | InChI=1S/C17H24N6O2/c1-13(16-20-18-12-21(16)2)19-17(24)23-10-8-22(9-11-23)14-4-6-15(25-3)7-5-14/h4-7,12-13H,8-11H2,1-3H3,(H,19,24)/t13-/m0/s1 |
| InChIKey | HCCRUKJLZDKSJO-ZDUSSCGKSA-N |
| XLogP | 1.42 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|