C20H24N2O3 — CID 95128017
N'-[(1S)-3-hydroxy-1-(4-methylphenyl)propyl]-N-(4-methylphenyl)propanediamide (PubChem CID 95128017) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is N'-[(1S)-3-hydroxy-1-(4-methylphenyl)propyl]-N-(4-methylphenyl)propanediamide.
| Compound Name | N'-[(1S)-3-hydroxy-1-(4-methylphenyl)propyl]-N-(4-methylphenyl)propanediamide |
|---|---|
| PubChem CID | 95128017 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N'-[(1S)-3-hydroxy-1-(4-methylphenyl)propyl]-N-(4-methylphenyl)propanediamide |
| SMILES | Cc1ccc(NC(=O)CC(=O)N[C@@H](CCO)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O3/c1-14-3-7-16(8-4-14)18(11-12-23)22-20(25)13-19(24)21-17-9-5-15(2)6-10-17/h3-10,18,23H,11-13H2,1-2H3,(H,21,24)(H,22,25)/t18-/m0/s1 |
| InChIKey | PRQJLOLQXHZJLG-SFHVURJKSA-N |
| XLogP | 2.87 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|