C19H25N5O — CID 95128687
(9aS)-2-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one (PubChem CID 95128687) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is (9aS)-2-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one.
| Compound Name | (9aS)-2-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 95128687 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | (9aS)-2-[(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)methyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one |
| SMILES | Cc1cc(CN2CCN3CCNC(=O)[C@@H]3C2)c(C)n1-c1cccnc1 |
| InChI | InChI=1S/C19H25N5O/c1-14-10-16(15(2)24(14)17-4-3-5-20-11-17)12-22-8-9-23-7-6-21-19(25)18(23)13-22/h3-5,10-11,18H,6-9,12-13H2,1-2H3,(H,21,25)/t18-/m0/s1 |
| InChIKey | VRNIOACZUOFWEL-SFHVURJKSA-N |
| XLogP | 1.11 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |