C18H22N4O2 — CID 95129192
2-ethyl-N-[[(2R)-oxolan-2-yl]methyl]-N-(pyridin-2-ylmethyl)pyrimidine-5-carboxamide (PubChem CID 95129192) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-ethyl-N-[[(2R)-oxolan-2-yl]methyl]-N-(pyridin-2-ylmethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-ethyl-N-[[(2R)-oxolan-2-yl]methyl]-N-(pyridin-2-ylmethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 95129192 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-ethyl-N-[[(2R)-oxolan-2-yl]methyl]-N-(pyridin-2-ylmethyl)pyrimidine-5-carboxamide |
| SMILES | CCc1ncc(C(=O)N(Cc2ccccn2)C[C@H]2CCCO2)cn1 |
| InChI | InChI=1S/C18H22N4O2/c1-2-17-20-10-14(11-21-17)18(23)22(13-16-7-5-9-24-16)12-15-6-3-4-8-19-15/h3-4,6,8,10-11,16H,2,5,7,9,12-13H2,1H3/t16-/m1/s1 |
| InChIKey | GXGBAGKWQSFIAX-MRXNPFEDSA-N |
| XLogP | 2.26 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |