C16H20N4OS — CID 95129993
(6R)-6-methyl-N-[2-(pyrazin-2-ylamino)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 95129993) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is (6R)-6-methyl-N-[2-(pyrazin-2-ylamino)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-methyl-N-[2-(pyrazin-2-ylamino)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 95129993 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (6R)-6-methyl-N-[2-(pyrazin-2-ylamino)ethyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C[C@@H]1CCc2c(C(=O)NCCNc3cnccn3)csc2C1 |
| InChI | InChI=1S/C16H20N4OS/c1-11-2-3-12-13(10-22-14(12)8-11)16(21)20-7-6-19-15-9-17-4-5-18-15/h4-5,9-11H,2-3,6-8H2,1H3,(H,18,19)(H,20,21)/t11-/m1/s1 |
| InChIKey | QWLLFWYWWVMVDE-LLVKDONJSA-N |
| XLogP | 2.50 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|