C19H28N4O — CID 95130438
2-[4-[(2R)-2-(3-methoxypropyl)piperidin-1-yl]quinazolin-2-yl]ethanamine (PubChem CID 95130438) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-[4-[(2R)-2-(3-methoxypropyl)piperidin-1-yl]quinazolin-2-yl]ethanamine.
| Compound Name | 2-[4-[(2R)-2-(3-methoxypropyl)piperidin-1-yl]quinazolin-2-yl]ethanamine |
|---|---|
| PubChem CID | 95130438 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 2-[4-[(2R)-2-(3-methoxypropyl)piperidin-1-yl]quinazolin-2-yl]ethanamine |
| SMILES | COCCC[C@H]1CCCCN1c1nc(CCN)nc2ccccc12 |
| InChI | InChI=1S/C19H28N4O/c1-24-14-6-8-15-7-4-5-13-23(15)19-16-9-2-3-10-17(16)21-18(22-19)11-12-20/h2-3,9-10,15H,4-8,11-14,20H2,1H3/t15-/m1/s1 |
| InChIKey | GDGLOSMYPKQRHC-OAHLLOKOSA-N |
| XLogP | 2.92 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|