About 2-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylamino]-N-pyrazin-2-ylacetamide
2-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylamino]-N-pyrazin-2-ylacetamide (PubChem CID 95131389) has the molecular formula C16H18N4O2
and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylamino]-N-pyrazin-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylamino]-N-pyrazin-2-ylacetamide |
| PubChem CID | 95131389 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylamino]-N-pyrazin-2-ylacetamide |
| SMILES | C[C@@H]1Cc2cc(CNCC(=O)Nc3cnccn3)ccc2O1 |
| InChI | InChI=1S/C16H18N4O2/c1-11-6-13-7-12(2-3-14(13)22-11)8-18-10-16(21)20-15-9-17-4-5-19-15/h2-5,7,9,11,18H,6,8,10H2,1H3,(H,19,20,21)/t11-/m1/s1 |
| InChIKey | LJWIBWGRVLNEGS-LLVKDONJSA-N |
| XLogP | 1.53 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylamino]-N-pyrazin-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylamino]-N-pyrazin-2-ylacetamide?
The IUPAC name of 2-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylamino]-N-pyrazin-2-ylacetamide (CID 95131389) is 2-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylamino]-N-pyrazin-2-ylacetamide.
What is the SMILES notation for 2-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylamino]-N-pyrazin-2-ylacetamide?
The canonical SMILES for 2-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylamino]-N-pyrazin-2-ylacetamide is C[C@@H]1Cc2cc(CNCC(=O)Nc3cnccn3)ccc2O1.
What is the InChIKey of 2-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylamino]-N-pyrazin-2-ylacetamide?
The InChIKey is LJWIBWGRVLNEGS-LLVKDONJSA-N. The full InChI is InChI=1S/C16H18N4O2/c1-11-6-13-7-12(2-3-14(13)22-11)8-18-10-16(21)20-15-9-17-4-5-19-15/h2-5,7,9,11,18H,6,8,10H2,1H3,(H,19,20,21)/t11-/m1/s1.
What are the key properties of 2-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylamino]-N-pyrazin-2-ylacetamide?
2-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylamino]-N-pyrazin-2-ylacetamide has a molecular weight of 298.35 g/mol, XLogP of 1.53, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylamino]-N-pyrazin-2-ylacetamide is sourced from PubChem (CID 95131389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).