C15H25N5O3S — CID 95131678
N-[[(3R)-1-methylsulfonylpiperidin-3-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine (PubChem CID 95131678) has the molecular formula C15H25N5O3S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-[[(3R)-1-methylsulfonylpiperidin-3-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-[[(3R)-1-methylsulfonylpiperidin-3-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 95131678 |
| Molecular Formula | C15H25N5O3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-[[(3R)-1-methylsulfonylpiperidin-3-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine |
| SMILES | CS(=O)(=O)N1CCC[C@H](CNc2cc(N3CCOCC3)ncn2)C1 |
| InChI | InChI=1S/C15H25N5O3S/c1-24(21,22)20-4-2-3-13(11-20)10-16-14-9-15(18-12-17-14)19-5-7-23-8-6-19/h9,12-13H,2-8,10-11H2,1H3,(H,16,17,18)/t13-/m1/s1 |
| InChIKey | RSPSZGPLYDPMHS-CYBMUJFWSA-N |
| XLogP | 0.40 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |