C20H21NO4 — CID 95132328
N-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyl]-5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-carboxamide (PubChem CID 95132328) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyl]-5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-carboxamide.
| Compound Name | N-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyl]-5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 95132328 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-[[(1S)-3,4-dihydro-1H-isochromen-1-yl]methyl]-5-(3-hydroxy-3-methylbut-1-ynyl)furan-2-carboxamide |
| SMILES | CC(C)(O)C#Cc1ccc(C(=O)NC[C@H]2OCCc3ccccc32)o1 |
| InChI | InChI=1S/C20H21NO4/c1-20(2,23)11-9-15-7-8-17(25-15)19(22)21-13-18-16-6-4-3-5-14(16)10-12-24-18/h3-8,18,23H,10,12-13H2,1-2H3,(H,21,22)/t18-/m1/s1 |
| InChIKey | VDIKSVPQXUHMNH-GOSISDBHSA-N |
| XLogP | 2.45 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|