C20H28N4O2 — CID 95132420
(2R)-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide (PubChem CID 95132420) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (2R)-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide.
| Compound Name | (2R)-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
|---|---|
| PubChem CID | 95132420 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (2R)-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
| SMILES | CCCn1cnnc1CNC(=O)[C@@H](CC)Oc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C20H28N4O2/c1-3-11-24-14-22-23-19(24)13-21-20(25)18(4-2)26-17-10-9-15-7-5-6-8-16(15)12-17/h9-10,12,14,18H,3-8,11,13H2,1-2H3,(H,21,25)/t18-/m1/s1 |
| InChIKey | AJSPMFLEQZJVRG-GOSISDBHSA-N |
| XLogP | 3.04 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |