C21H29N3O — CID 95132932
[(3R)-1-[2-[5-[(E)-but-2-en-2-yl]-4-phenylimidazol-1-yl]ethyl]piperidin-3-yl]methanol (PubChem CID 95132932) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is [(3R)-1-[2-[5-[(E)-but-2-en-2-yl]-4-phenylimidazol-1-yl]ethyl]piperidin-3-yl]methanol.
| Compound Name | [(3R)-1-[2-[5-[(E)-but-2-en-2-yl]-4-phenylimidazol-1-yl]ethyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 95132932 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | [(3R)-1-[2-[5-[(E)-but-2-en-2-yl]-4-phenylimidazol-1-yl]ethyl]piperidin-3-yl]methanol |
| SMILES | C/C=C(\C)c1c(-c2ccccc2)ncn1CCN1CCC[C@@H](CO)C1 |
| InChI | InChI=1S/C21H29N3O/c1-3-17(2)21-20(19-9-5-4-6-10-19)22-16-24(21)13-12-23-11-7-8-18(14-23)15-25/h3-6,9-10,16,18,25H,7-8,11-15H2,1-2H3/b17-3+/t18-/m1/s1 |
| InChIKey | JWFYPQYVZIIAPU-KCNOKRAYSA-N |
| XLogP | 3.68 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |