C17H17NO3S — CID 95133091
6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl-[(2R,3S)-2-methyl-2,3-dihydro-1,4-benzodioxin-3-yl]methanone (PubChem CID 95133091) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is 6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl-[(2R,3S)-2-methyl-2,3-dihydro-1,4-benzodioxin-3-yl]methanone.
| Compound Name | 6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl-[(2R,3S)-2-methyl-2,3-dihydro-1,4-benzodioxin-3-yl]methanone |
|---|---|
| PubChem CID | 95133091 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl-[(2R,3S)-2-methyl-2,3-dihydro-1,4-benzodioxin-3-yl]methanone |
| SMILES | C[C@H]1Oc2ccccc2O[C@@H]1C(=O)N1CCc2sccc2C1 |
| InChI | InChI=1S/C17H17NO3S/c1-11-16(21-14-5-3-2-4-13(14)20-11)17(19)18-8-6-15-12(10-18)7-9-22-15/h2-5,7,9,11,16H,6,8,10H2,1H3/t11-,16+/m1/s1 |
| InChIKey | BRKRFUHVTHJFEA-BZNIZROVSA-N |
| XLogP | 2.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |