C16H17N3O2S2 — CID 95133157
(8R)-2-amino-8-[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-c]azepin-6-one (PubChem CID 95133157) has the molecular formula C16H17N3O2S2 and a molecular weight of 347.47 g/mol. Its IUPAC name is (8R)-2-amino-8-[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-c]azepin-6-one.
| Compound Name | (8R)-2-amino-8-[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-c]azepin-6-one |
|---|---|
| PubChem CID | 95133157 |
| Molecular Formula | C16H17N3O2S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (8R)-2-amino-8-[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-c]azepin-6-one |
| SMILES | CC(C)(O)C#Cc1ccc([C@H]2CC(=O)NCc3nc(N)sc32)s1 |
| InChI | InChI=1S/C16H17N3O2S2/c1-16(2,21)6-5-9-3-4-12(22-9)10-7-13(20)18-8-11-14(10)23-15(17)19-11/h3-4,10,21H,7-8H2,1-2H3,(H2,17,19)(H,18,20)/t10-/m1/s1 |
| InChIKey | OKCSCWVGDRHMLF-SNVBAGLBSA-N |
| XLogP | 2.06 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|