C15H27N3O4S — CID 95133490
N-[(1R)-1-cyclopentyl-2-[(3S)-3-(methanesulfonamido)piperidin-1-yl]-2-oxoethyl]acetamide (PubChem CID 95133490) has the molecular formula C15H27N3O4S and a molecular weight of 345.47 g/mol. Its IUPAC name is N-[(1R)-1-cyclopentyl-2-[(3S)-3-(methanesulfonamido)piperidin-1-yl]-2-oxoethyl]acetamide.
| Compound Name | N-[(1R)-1-cyclopentyl-2-[(3S)-3-(methanesulfonamido)piperidin-1-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 95133490 |
| Molecular Formula | C15H27N3O4S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-[(1R)-1-cyclopentyl-2-[(3S)-3-(methanesulfonamido)piperidin-1-yl]-2-oxoethyl]acetamide |
| SMILES | CC(=O)N[C@@H](C(=O)N1CCC[C@H](NS(C)(=O)=O)C1)C1CCCC1 |
| InChI | InChI=1S/C15H27N3O4S/c1-11(19)16-14(12-6-3-4-7-12)15(20)18-9-5-8-13(10-18)17-23(2,21)22/h12-14,17H,3-10H2,1-2H3,(H,16,19)/t13-,14+/m0/s1 |
| InChIKey | ILEFZOLJZVCOKI-UONOGXRCSA-N |
| XLogP | 0.22 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |