C16H21N5O — CID 95133629
1-cyclopropyl-3-[(2S)-1-imidazol-1-ylpropan-2-yl]-1-(pyridin-2-ylmethyl)urea (PubChem CID 95133629) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(2S)-1-imidazol-1-ylpropan-2-yl]-1-(pyridin-2-ylmethyl)urea.
| Compound Name | 1-cyclopropyl-3-[(2S)-1-imidazol-1-ylpropan-2-yl]-1-(pyridin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 95133629 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-cyclopropyl-3-[(2S)-1-imidazol-1-ylpropan-2-yl]-1-(pyridin-2-ylmethyl)urea |
| SMILES | C[C@@H](Cn1ccnc1)NC(=O)N(Cc1ccccn1)C1CC1 |
| InChI | InChI=1S/C16H21N5O/c1-13(10-20-9-8-17-12-20)19-16(22)21(15-5-6-15)11-14-4-2-3-7-18-14/h2-4,7-9,12-13,15H,5-6,10-11H2,1H3,(H,19,22)/t13-/m0/s1 |
| InChIKey | CPLJNJWTPNNLQS-ZDUSSCGKSA-N |
| XLogP | 2.04 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |