About 3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methylurea
3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methylurea (PubChem CID 95133818) has the molecular formula C15H22N2O3S
and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methylurea.
Molecular Properties
| Compound Name | 3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methylurea |
| PubChem CID | 95133818 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methylurea |
| SMILES | COC[C@H](O)CN(C)C(=O)N[C@@H]1CCSc2ccccc21 |
| InChI | InChI=1S/C15H22N2O3S/c1-17(9-11(18)10-20-2)15(19)16-13-7-8-21-14-6-4-3-5-12(13)14/h3-6,11,13,18H,7-10H2,1-2H3,(H,16,19)/t11-,13-/m1/s1 |
| InChIKey | SABZFFWRBWZTCH-DGCLKSJQSA-N |
| XLogP | 1.87 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methylurea?
The IUPAC name of 3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methylurea (CID 95133818) is 3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methylurea.
What is the SMILES notation for 3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methylurea?
The canonical SMILES for 3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methylurea is COC[C@H](O)CN(C)C(=O)N[C@@H]1CCSc2ccccc21.
What is the InChIKey of 3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methylurea?
The InChIKey is SABZFFWRBWZTCH-DGCLKSJQSA-N. The full InChI is InChI=1S/C15H22N2O3S/c1-17(9-11(18)10-20-2)15(19)16-13-7-8-21-14-6-4-3-5-12(13)14/h3-6,11,13,18H,7-10H2,1-2H3,(H,16,19)/t11-,13-/m1/s1.
What are the key properties of 3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methylurea?
3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methylurea has a molecular weight of 310.42 g/mol, XLogP of 1.87, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-1-[(2R)-2-hydroxy-3-methoxypropyl]-1-methylurea is sourced from PubChem (CID 95133818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).