C18H28N4O2 — CID 95134910
1-[2-(cyclohexen-1-yl)ethyl]-3-[(4S)-1-(2-hydroxyethyl)-4,5,6,7-tetrahydroindazol-4-yl]urea (PubChem CID 95134910) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-[(4S)-1-(2-hydroxyethyl)-4,5,6,7-tetrahydroindazol-4-yl]urea.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[(4S)-1-(2-hydroxyethyl)-4,5,6,7-tetrahydroindazol-4-yl]urea |
|---|---|
| PubChem CID | 95134910 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[(4S)-1-(2-hydroxyethyl)-4,5,6,7-tetrahydroindazol-4-yl]urea |
| SMILES | O=C(NCCC1=CCCCC1)N[C@H]1CCCc2c1cnn2CCO |
| InChI | InChI=1S/C18H28N4O2/c23-12-11-22-17-8-4-7-16(15(17)13-20-22)21-18(24)19-10-9-14-5-2-1-3-6-14/h5,13,16,23H,1-4,6-12H2,(H2,19,21,24)/t16-/m0/s1 |
| InChIKey | FHSKVLYCBKXISM-INIZCTEOSA-N |
| XLogP | 2.44 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|