C16H21N3O4 — CID 95135179
(3R)-3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)piperidine-1-carboxamide (PubChem CID 95135179) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is (3R)-3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95135179 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (3R)-3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)piperidine-1-carboxamide |
| SMILES | CC(=O)N[C@@H]1CCCN(C(=O)NCc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C16H21N3O4/c1-11(20)18-13-3-2-6-19(9-13)16(21)17-8-12-4-5-14-15(7-12)23-10-22-14/h4-5,7,13H,2-3,6,8-10H2,1H3,(H,17,21)(H,18,20)/t13-/m1/s1 |
| InChIKey | VTBSZVPZGGDRQL-CYBMUJFWSA-N |
| XLogP | 1.23 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |