About (2S)-N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-4-methoxy-4-methylpentan-2-amine
(2S)-N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-4-methoxy-4-methylpentan-2-amine (PubChem CID 95135544) has the molecular formula C14H26ClN3O
and a molecular weight of 287.84 g/mol. Its IUPAC name is (2S)-N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-4-methoxy-4-methylpentan-2-amine.
Molecular Properties
| Compound Name | (2S)-N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-4-methoxy-4-methylpentan-2-amine |
| PubChem CID | 95135544 |
| Molecular Formula | C14H26ClN3O |
| Molecular Weight | 287.84 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | (2S)-N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-4-methoxy-4-methylpentan-2-amine |
| SMILES | COC(C)(C)C[C@H](C)NCCn1nc(C)c(Cl)c1C |
| InChI | InChI=1S/C14H26ClN3O/c1-10(9-14(4,5)19-6)16-7-8-18-12(3)13(15)11(2)17-18/h10,16H,7-9H2,1-6H3/t10-/m0/s1 |
| InChIKey | WUNFYLLHVKQFOI-JTQLQIEISA-N |
| XLogP | 2.95 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.84 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-4-methoxy-4-methylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-4-methoxy-4-methylpentan-2-amine?
The IUPAC name of (2S)-N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-4-methoxy-4-methylpentan-2-amine (CID 95135544) is (2S)-N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-4-methoxy-4-methylpentan-2-amine.
What is the SMILES notation for (2S)-N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-4-methoxy-4-methylpentan-2-amine?
The canonical SMILES for (2S)-N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-4-methoxy-4-methylpentan-2-amine is COC(C)(C)C[C@H](C)NCCn1nc(C)c(Cl)c1C.
What is the InChIKey of (2S)-N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-4-methoxy-4-methylpentan-2-amine?
The InChIKey is WUNFYLLHVKQFOI-JTQLQIEISA-N. The full InChI is InChI=1S/C14H26ClN3O/c1-10(9-14(4,5)19-6)16-7-8-18-12(3)13(15)11(2)17-18/h10,16H,7-9H2,1-6H3/t10-/m0/s1.
What are the key properties of (2S)-N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-4-methoxy-4-methylpentan-2-amine?
(2S)-N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-4-methoxy-4-methylpentan-2-amine has a molecular weight of 287.84 g/mol, XLogP of 2.95, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[2-(4-chloro-3,5-dimethylpyrazol-1-yl)ethyl]-4-methoxy-4-methylpentan-2-amine is sourced from PubChem (CID 95135544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).