C18H30N4 — CID 95135800
5-ethyl-2-methyl-4-[4-[(1R)-1-pyrrolidin-1-ylethyl]piperidin-1-yl]pyrimidine (PubChem CID 95135800) has the molecular formula C18H30N4 and a molecular weight of 302.47 g/mol. Its IUPAC name is 5-ethyl-2-methyl-4-[4-[(1R)-1-pyrrolidin-1-ylethyl]piperidin-1-yl]pyrimidine.
| Compound Name | 5-ethyl-2-methyl-4-[4-[(1R)-1-pyrrolidin-1-ylethyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 95135800 |
| Molecular Formula | C18H30N4 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 5-ethyl-2-methyl-4-[4-[(1R)-1-pyrrolidin-1-ylethyl]piperidin-1-yl]pyrimidine |
| SMILES | CCc1cnc(C)nc1N1CCC([C@@H](C)N2CCCC2)CC1 |
| InChI | InChI=1S/C18H30N4/c1-4-16-13-19-15(3)20-18(16)22-11-7-17(8-12-22)14(2)21-9-5-6-10-21/h13-14,17H,4-12H2,1-3H3/t14-/m1/s1 |
| InChIKey | LUJYSLAARICRRL-CQSZACIVSA-N |
| XLogP | 3.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |