C19H16F3N3O — CID 95135914
(14R)-4-methyl-14-[4-(trifluoromethyl)phenyl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one (PubChem CID 95135914) has the molecular formula C19H16F3N3O and a molecular weight of 359.35 g/mol. Its IUPAC name is (14R)-4-methyl-14-[4-(trifluoromethyl)phenyl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one.
| Compound Name | (14R)-4-methyl-14-[4-(trifluoromethyl)phenyl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
|---|---|
| PubChem CID | 95135914 |
| Molecular Formula | C19H16F3N3O |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (14R)-4-methyl-14-[4-(trifluoromethyl)phenyl]-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
| SMILES | Cc1ccc2nc3c(n2c1)[C@@H](c1ccc(C(F)(F)F)cc1)CC(=O)NC3 |
| InChI | InChI=1S/C19H16F3N3O/c1-11-2-7-16-24-15-9-23-17(26)8-14(18(15)25(16)10-11)12-3-5-13(6-4-12)19(20,21)22/h2-7,10,14H,8-9H2,1H3,(H,23,26)/t14-/m1/s1 |
| InChIKey | LYPNYKUWOITNDG-CQSZACIVSA-N |
| XLogP | 3.81 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |